Write the expression for Ka for the acid HNO3 (and how you got it)

Answer:

See explanation

Explanation:

We know that the possession of polar bonds does not make a molecule polar. The BeCl2 molecule has Be-Cl bonds which are polar. However, the molecule is symmetrical and has a zero net dipole moment hence the molecule is nonpolar.

H2O is a polar molecule. It has polar O-H bonds. The molecule is bent and has a resultant dipole moment hence it is polar.

Ozone is a triatomic molecule which is bent in shape. This bent geometry creates an overall dipole moment in the molecule, hence the molecule is polar.

Transition metal sulfide widespread availability and versatile synthesis processes for photocatalytic degradation and battery. The given statement is true .

The effectiveness and accessibility of transition metal sulfides (TMS) as general water splitting substitutes for precious metals have been thoroughly investigated. Here, recent developments pertaining to TMS-based bifunctional electrocatalysts have been systematically and thoroughly summarized. These developments cover preparation techniques, intrinsic electrocatalytic performance, and optimization techniques.

To provide direction for creating TMS materials with well-defined structures, adjustable compositions, and outstanding performance, the physicochemical features of TMS and common synthesis techniques are described.

As a significant family of inorganic materials, transition metal sulfides are good electrode materials for a range of electrochemical energy storage systems, including lithium-ion batteries, sodium-ion batteries, supercapacitors, and others.

For more information on transition metal sulfide kindly visit to

https://brainly.com/question/15411329?

#SPJ4

Exothermic refers to chemical interactions that aerobic respiration. Combustion reactions release higher energy. Endothermic refers to atoms and molecules that either use or absorb reactive power.

A chemical process known as an endothermic releases energy as heat or light. It is an endothermic reaction's opposite. Chemical equation expressed as reactants + products + energy. An reaction mechanism is one in which electricity is given off as light or warmth.

A response is deemed to be exothermic if it produces heat while also undergoing a net decrease in basic enthalpy change. Samples include those type of combustion, iron rust, including water froze. Exothermic processes are those that discharge heat and energy into the surroundings.

To know more about exothermic visit:

https://brainly.com/question/13243759

#SPJ1

Explanation:

To calculate the amount of water that was heated, we can use the formula:

q = m * c * ΔT

where q is the amount of heat absorbed by the water, m is the mass of the water, c is the specific heat capacity of water (4.18 J/(g * °C)), and ΔT is the temperature change.

In this case, we know that 2.71 grams of fuel released 4.10 kJ of energy into some amount of water, causing its temperature to change from 22.2 C to 53.1 C. Let's first convert the energy released to joules:

4.10 kJ = 4,100 J

Next, we can calculate the amount of heat absorbed by the water using the formula above:

4,100 J = m * 4.18 J/(g * °C) * (53.1 C - 22.2 C)

Simplifying and solving for m, we get:

m = 152.3 g

Therefore, approximately 152.3 grams of water were heated by the combustion of 2.71 grams of the fuel.

Plants produce their nourishment through a process called photosynthesis. They generate energy in the shape of glucose using water, carbon dioxide, and sunshine.

Because the body doesn't produce enough insulin, hyperglycemia (increased blood glucose) occurs when there is excessive sugar in the blood. Hyperglycemia, a sign of diabetes, can lead to vomiting, intense hunger and thirst, a rapid heartbeat, eyesight issues, and other complaints.

High blood glucose concentrations can be caused by eating more carbs than what the body can utilize. The reason for this is that the body converts carbohydrate into simple sugars. Ineffective cell removal of carbohydrates from the blood results in the body storing it as fat in the tissues. Weight gain may result from this.

To know more about glucose visit:

https://brainly.com/question/2396657

#SPJ1

Answer:

yes

Explanation:

yes it is

The enthalpy of combustion for 1kg of urea is -1223525.84 J/mol.

Urea is a compound that is used in fertilizers and in some plastics.The enthalpy of combustion for urea is the amount of energy that is released when urea is burned. In order to calculate the enthalpy of combustion for 1kg of urea, we need to use the information that is provided to us in the question. Let us start by writing down the balanced equation for the combustion of urea: CO(NH2)2 + 3/2 O2 → CO2 + 2H2O + N2
The balanced equation shows that 1 mole of urea reacts with 1.5 moles of oxygen gas to produce 1 mole of carbon dioxide, 2 moles of water, and 1 mole of nitrogen gas. The enthalpy change for this reaction is equal to the amount of energy that is released when 1 mole of urea is burned.
The heat of combustion (ΔHc) of urea is -632.6 kJ/mol. This means that 632.6 kJ of energy is released when 1 mole of urea is burned. We know that 12g of urea raised the temperature of water by 30°C. We can use this information to calculate the amount of energy that was released when 12g of urea was burned.
The specific heat capacity of water is 4.18 J/g°C. This means that it takes 4.18 J of energy to raise the temperature of 1 gram of water by 1°C. Therefore, it takes 4.18 x 1000 = 4180 J of energy to raise the temperature of 1 kg of water by 1°C.
We know that 12g of urea raised the temperature of water by 30°C. Therefore, the amount of energy that was released when 12g of urea was burned is:
Energy = mass x specific heat capacity x temperature change
Energy = 0.012 kg x 4180 J/kg°C x 30°C
Energy = 1497.6 J
We can now use this information to calculate the enthalpy of combustion for 1kg of urea:
Enthalpy of combustion = energy released / moles of urea burned
Enthalpy of combustion = 1497.6 J / (0.012 kg / 60.06 g/mol)
Enthalpy of combustion = - 1223525.84 J/mol
for such more questions on enthalpy
https://brainly.com/question/14047927

#SPJ8

The amount of time of contact, the area of contact, and the specific heats of the substances. Hence, option A is correct.

The heat in calories is required to raise the temperature of one gram of a substance one degree Celsius.

Factors that affect the rate of heat flow include the conductivity of the material, the temperature difference across the material, the thickness of the material, and the area of the material.

Different materials have greater or lesser resistance to heat transfer, making them better insulators or better conductors.

The amount of time of contact, the area of contact, and the specific heats of the substances.

Hence, option A is correct.

Learn more about the  specific heats here:

https://brainly.com/question/11297584

#SPJ1

Answer: The answer is C and D

B: If a substance undergoes a physical change, then it will retain most of its original properties because no new substance is formed.

C: If a substance undergoes a chemical change, then it will not retain its original properties because a new substance is formed.

Explanation: I took the test on edg

Answer:

Pb(s) + N2(g) + 3O2(g) --> Pb(NO3)2

Explanation:

The balanced chemical equation for the standard formation reaction of lead(II) nitrate is:

\(Pb(s)\; + N_2(g) + 3O_2(g) \longrightarrow Pb(NO_3)_2 \;(s)\)

A chemical equation expresses a reaction in terms of symbols of the substances. An equation consists of participated reactants, formed products, and an arrow indicating the direction of change.

The equation in which the number of atoms of substances is equal on either side of the equation is called a balanced chemical equation.

The law of conservation of mass should follow during the balancing of a chemical equation. According to this law, during a chemical reaction, the mass can neither be created nor destroyed.

By following this law, the total mass of the chemical elements on the reactant side should be equal to the total mass of chemical elements on the product side in a balanced chemical equation.

The solid lead(II) nitrate is firmed from the reaction of solid lead, nitrogen, and oxygen gas.

\(Pb(s)\; + N_2(g) + 3O_2(g) \longrightarrow Pb(NO_3)_2 \;(s)\)

Learn more about the balanced chemical equation, here:

brainly.com/question/15052184

#SPJ3

Reaction B will not lead to formation of 50/50 mixture of stereoisomers products.So,correct option is a.

In stereochemistry, stereoisomerism, or spatial isomerism, is a type of isomerism wherein particles have similar sub-atomic equation and succession of fortified iotas (constitution), however vary in the three-layered directions of their molecules in space.[1][2] This differences with underlying isomers, what share a similar sub-atomic recipe, yet the bond associations or their request contrasts. By definition, particles that are stereoisomers of one another address the equivalent primary isomer.

In reaction b compound is existing in original form,due to which for stability it transfers electrons from central atom to top most atom of compound which is not possible in first reaction compound.Due to that reaction A will lead to 100% mixture.

Hence,correct option is a.

To know more about stereoisomers,visit here:

https://brainly.com/question/13149072

#SPJ4

(Complete question) is:

which of the following reactions would not result in a 50/50 mixture of stereoisomeric products?

a)reaction b

b)neither reaction a nor b

c) both reaction a and b

d)reaction a

Answer:

i think sulfur fluoride

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

In the reaction 239/93 Np -> 239/94 Pu + X, the symbol "X" represents an electron. Option C is correct.

This reaction involves the radioactive decay of Neptunium-239 (239/93 Np) into Plutonium-239 (239/94 Pu). Specifically, it undergoes beta decay, which involves the emission of an electron.

During beta decay, a neutron in the Neptunium-239 nucleus is converted into a proton, and an electron (also known as a beta particle) is emitted. The electron carries a negative charge (-1) and is represented by the symbol "e^-" or simply "e". It balances the charge and atomic number in the reaction equation.

The balanced equation for the reaction is:

239/93 Np -> 239/94 Pu + 0/-1 e

So, in summary, the symbol "X" in the reaction 239/93 Np -> 239/94 Pu + X represents an electron (e^-) emitted during the beta decay of Neptunium-239.

For more question on electron click on

https://brainly.com/question/26084288

#SPJ11

COMPLETE QUESTION

in the reaction 239/93 Np -> 239/94 Pu+X, what does X represent

A. PROTON

B. POSITRON

C. ELECTRON

D. NEUTRON

Answer:

residue is whatever remains after something else has been removed while filtrate is the liquid or solution that has passed through a filter, and which has been separated from the filtride.

filtration id done by placing a filter paper on the beaker or container then pour the filtride then let it settle and it will pass through and you will have the fitrate and residue

Explanation:

The percent yield of a chemical response is the proportion of the real yield to the hypothetical yield, communicated as a rate.

In this case, the hypothetical yield is 150 grams of sodium hydroxide, as calculated by the researcher. The genuine yield is 135 grams of sodium hydroxide, as gotten from the experiment.

The percent yield can be calculated utilizing the equation:

Percent yield = (real yield / hypothetical yield) x 100%

Substituting the values given within the issue, we get:

Percent  yield= (135 / 150) x 100%

Percent yield = 0.9 x 100%

Percent yield = 90%

Hence, the percent yield of the experiment is 90%. This implies that 90% of the hypothetical abdicate was gotten within the test.

Learn more about percentage yield from

https://brainly.com/question/26499645

#SPJ1

Answer:

they are the same element because they have the same number of protons and electrons,but a different number of neutrons

Considering the phase diagram, the state of matter that exists in area B is gas.

The correct option is A.

A phase diagram is a graphical representation that shows the conditions of temperature and pressure at which different phases or states of a substance exist.

The axes of a phase diagram typically represent temperature (usually on the horizontal axis) and pressure (usually on the vertical axis). The diagram is divided into regions that correspond to different phases, and the lines separating these regions represent phase boundaries.

The point where three phase boundaries meet is known as the triple point, which represents the temperature and pressure at which all three phases can coexist in equilibrium.

Learn more about phase diagrams at: https://brainly.com/question/28097253

#SPJ1

Based on the given reactions, the compounds are as follows:

A: The specific product formed from the reaction between prop-1-yne and either 2HBr or H2O2.

B: The product formed when compound A reacts with 2H2O.

C: The product formed when compound B reacts with K2CO3(aq).

D: The product formed from the heat-induced reaction of compound C.

E: The product formed when compound D reacts with HBr.

Based on the given reactions, let's analyze the compounds involved:

Reaction 1: prop-1-yne + 2HBr/H2O2 = A

The reactant prop-1-yne reacts with either 2HBr or H2O2 to form compound A. The specific product formed will depend on the reaction conditions.

Reaction 2: A + 2H2O = B

Compound A reacts with 2H2O (water) to form compound B.

Reaction 3: B + K2CO3(aq) = C

Compound B reacts with K2CO3(aq) (potassium carbonate dissolved in water) to form compound C.

Reaction 4: C + heat = D

Compound C undergoes a heat-induced reaction to form compound D.

Reaction 5: D + HBr = E

Compound D reacts with HBr (hydrobromic acid) to form compound E.

For more such questions on compounds

https://brainly.com/question/704297

#SPJ8

At pOH value  of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)

In this question we will apply the formula

      pH +pOH = 14 . . . . . . . . . . . . .(1)

where pH = concentration of [\(H^{+}\) ] ion

pOH = concentration of [\(OH^{-}\) ] ion

As per the question

pOH =6.0

Putting the value of pOH in equation (1) we get the value of pH

              pH + 6.0 =14

             pH = 14 -6.0

             pH  = 8.0

 The value of pH if the pOH value is 6.0 is 8.0

To find the concentration of \(H^{+}\) ion we will use the following formula

This is calculated by the formula

                                 [\(H^{+}\)} = \(10^{-pH}\)

where we will write the values of pH

Hence the concentration of [\(H^{+}\)} ion is \(10^{-8}\)

Therefore at  pOH of 6.0 the pH value of the following solution is 8.0 and the concentration of [\(H^{+}\) ] ion is \(10^{-8}\)

Read more about pH

https://brainly.com/question/11300720

The complete question is -

What is the pH value and concentration of [\(H^{+}\) ] ion of the following if the pOH value of the solution is 6.0 ?

Answer:

There are 40.25 days in 5.75 weeks

Answer: 40.25

Hope this helped! :)

V = 3.9 L

Explanation:

Given:

T = 23°C + 273 = 296K

n = 0.16 mol He

P = 101 kPa = 0.997 atm

R = universal gas constant = 0.08205 L-atm/mol-K

V = ?

Using the ideal gas law,

PV = nRT

V = nRT/P

= (0.16 mil He)(0.08205 L-atm/mol-K)(296K)/(0.997 atm)

= 3.9 L

Answer:

2.25×10¯³ mm.

Explanation:

From the question given above, we obtained the following information:

Diameter in micrometer = 2.25 μm

Diameter in millimetre (mm) =?

Next we shall convert 2.25 μm to metre (m). This can be obtained as follow:

1 μm = 1×10¯⁶ m

Therefore,

2.25 μm = 2.25 μm / 1 μm × 1×10¯⁶ m

2.25 μm = 2.25×10¯⁶ m

Finally, we shall convert 2.25×10¯⁶ m to millimetre (mm) as follow:

1 m = 1000 mm

Therefore,

2.25×10¯⁶ m = 2.25×10¯⁶ m /1 m × 1000 mm

2.25×10¯⁶ m = 2.25×10¯³ mm

Therefore, 2.25 μm is equivalent to 2.25×10¯³ mm.

Mass NaCl produced : 171.81 g

The reaction equation is the chemical formula of reagents and product substances  

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products  

Na₂SO₃ : 176 g

MW : 126,043 g/mol

mol :

\(\tt \dfrac{176}{126.043}=1.4\)

AlCl₃ : 65 g

MW : 133,34 g/mol

mol :

\(\tt \dfrac{65}{133.34}=0.49\)

Reaction

Na₂SO₃ + 2 AlCl₃ ⇒ Al₂(SO₃)₃ + 6NaCl

limiting reactants:

mol ratio(mol/coefficient) Na₂SO₃ : 2 AlCl₃ =

\(\tt \dfrac{1.4}{1}:\dfrac{0.49}{2}=1.4:0.245\)

AlCl₃ ⇒ limiting reactants(smaller ratio)

mol NaCl from limiting reactants :

\(\tt \dfrac{6}{1}\times 0.49=2.94\)

mass NaCl

\(\tt mol\times MW=2.94\times 58,44~g/mol=171.81~g\)

Answer:

pH meter measures the degree of acidity or alkalinity in a substance. The H+ ions measures its acidity and the OH- measures the alkalinity.It usually has a voltmeter which is connected to a pH-responsive electrode and a standard electrode which has no degree of variation.

The potentiometric ph meter works functions by measuring the voltage between two electrodes and the result are usually displayed after conversion into the corresponding pH value takes place.

Find out how many valence electrons there are in total. Step 2: Write down the molecule's skeleton structure. Step 3: Each bond in the skeleton structure is formed by using two valence electrons.

First, the sum of the valencies of each atom determines the total number of valence electrons in the molecule.

The Lewis dot structure gains electrons (number of electrons added equals magnitude of negative charge) if the molecule is an anion.

A Lewis electron dot diagram, also known as an electron dot diagram, Lewis diagram, or Lewis structure, is a way to show the valence electrons in an atom by placing dots around the symbol for the element. The number of valence electrons in the atom is depicted by the diagram's number of dots. The atom symbol is surrounded by dots that represent the electrons in the outer shell. These symbols are referred to as Lewis symbols and electron dot symbols.

Learn more about lewis structure:

brainly.com/question/28384183

#SPJ1

Step 1 - Understanding what "reversible" means

Suppose we have a sample of water. If we warm it up, the water will become vapour. That's what we call a physical process.

But this is not a unidirectional physical process. In much the same way, we could cool down a sample of water vapour, thus obtaining liquid water once again. This would be a reversible process.

In nature, both things are happening at the same time. In the surface of a lake, for example, water is becoming vapour at the same time that water vapour in the atmosphere is turning to liquid water. This is a situation we call physical equilibrium.

Step 2 - Can we have chemical equilibrium as well?

In a chemical reaction, chemical bonds are broken in order to form new chemical bonds. The atoms are rearranged thus forming new molecules.

At the same time, the newly formed chemical bonds in the products can also be broken, and a new atom rearrangement would occur, restituting the reactants.

A chemical reaction, therefore, can be reversible and, in fact, most of them are reversible. Equilibrium is reached when the direct reaction and the inverse reaction are happening with the same velocity.