Which of these is a true
statement about energy?
Help Resources
A. Energy can be made in factories.
B. Wasted energy turns into other forms.
C. When we are done with nuclear energy we can
throw it away.

The temperature in kelvins of 23°C is 296 K, hence option D is the correct answer.

Here's how to convert Celsius to Kelvin.

T = Tc + 273.15 ---------_We basically add a factor of 273.15 to the temperature in Celsius to get the temperature in Kelvin

T = 23 + 273.15

T = 296 K

One Celsius degree and one kelvin are precisely the same on the Kelvin scale.

Learn more about temperature measurement here:

https://brainly.com/question/777464

#SPJ1

Answer:

Empirical formula of compound  is C₄H₈O

Explanation:

Given data:

Mass of compound = 5.60 g

Mass of CO₂ = 13.7 g

Mass of H₂O = 5.60 g

Empirical formula of compound = ?

Solution:

Percentage of C:

13.7 g/5.60 g × 12/44× 100

2.45×0.273× 100 = 66.9%

Percentage of H:

5.60 g/ 5.60 g × 2.016/18 × 100

11.2%

Percentage of O:

(66.9% + 11.2%) - 100 = 21.9%

Grams atom of  C , H, O

66.9/12 = 5.6

11.2 / 1.008 = 11.11

21.9 / 16 = 1.4

Atomic ratio:

           C                 :               H           :              O

           5.6/1.4         :            11.11/1.4    :            1.4/1.4

              4                :               8            :               1

Empirical formula:

C₄H₈O

The Percentage Yield is 63.9%

Hello

To solve this problem, we would calculate the theoritical yield of the reaction first.

The theoritical yield of the reaction can be calculated using the equation of reaction.

Given that 2 moles of C₂H₂ will produce 4 moles of CO₂

This implies that

2*26g (from molar mass of C₂H₂) will produce 4*44g of CO₂

52g of C₂H₂ = 176g of CO₂

21.5g of C₂H₂ = xg of CO₂

cross multiply and solve for x

From the calculation above, the theoritical yield of CO₂ is 72.77g

Let's use this information and solve for the percentage yield.

This is the ratio between the actual yield to the theoritical yield and multiplied by 100.

Mathematically,

Data;

Actual yield = 46.5g

Theoritical yield = 72.77g

percentage yield = ?

From the calculations above, the Percentage Yield is 63.9%

It is necessary for astronauts on the International Space Station to generate and recycle oxygen because There is not enough oxygen in space to sustain life.

The correct answer choice is" There is not enough oxygen in space to sustain life."

In space, there is no breathable air as there is on Earth, and the amount of oxygen available is limited. Astronauts need a constant supply of oxygen to breathe and to sustain their bodily functions.

Therefore, the International Space Station has a closed-loop life support system that generates and recycles oxygen. This system converts carbon dioxide exhaled by the astronauts into oxygen through a process called electrolysis.

The generated oxygen is then supplied back into the station's atmosphere. This process helps ensure that the astronauts have a constant supply of breathable air and can survive in the space station for extended periods of time.

Therefore "There is not enough oxygen in space to sustain life." is the correct answer.

For more such questions on astronauts, click on:

https://brainly.com/question/14078735

#SPJ11

The two main postulates that was given by Antoine Lavoisier are, oxygen play an important role in combustion and the other is mass of the reactant and product is conserved. Therefore, the given statement is incorrect.

According to Law of conservation of mass, mass can neither be created nor be destroyed. Mass can only be transformed from one form to another. The law of conservation of mass was given by Antoine Lavoisier.

Every reaction in nature follow the law given by Antoine Lavoisier that is mass is always conserved. To see law of conservation, we need to check only number of atoms not the splitting of atoms or element. So, the given statement is incorrect.

Therefore, the given statement is incorrect.

To know more about law of conservation of mass, here:

https://brainly.com/question/28711001

#SPJ1

Answer:

Explanation:

40/ 180.2 x (-16 / 1 mole glucose)=-3.6 KJ

Answer:

Explanation:

The pH of 0.02 M hydrochloric acid is approximately 1.7.

THANKS

IF THE ANSWER IS CORRECT , THEN MARK ME AS BRAINLIST

Hydrogen bonding, which is unquestionably what we have, will occur from the intermolecular force between the molecules of H2O and CH3OH. Atoms trade or exchange valence electrons to create bonds.

Trust and self-esteem are developed in children and adolescents through strong emotional ties. After that, they can leave the family and establish wholesome friendships and other types of social ties. Healthy relationships consequently lower a child's chances of emotional discomfort or antisocial behaviour.

The government of a country issues government bonds, a sort of fixed-interest bond. These bonds are thought of as low-risk investments. Examples of different kinds of government bonds include T - bills, Municipality Bond, Zero-Coupon Bonds, and others.

To know more about intermolecular visit:

https://brainly.com/question/9007693

#SPJ1

In 1 mole of calcium carbonate, there are approximately 18.066 x 10^23 moles of oxygen.

To determine the number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3), we need to examine the chemical formula of calcium carbonate and identify the number of oxygen atoms present.

The chemical formula of calcium carbonate is CaCO3. In this formula, we have one calcium atom (Ca), one carbon atom (C), and three oxygen atoms (O).

The subscript numbers in the formula indicate the number of atoms for each element. Therefore, we have:

1 calcium atom (Ca)

1 carbon atom (C)

3 oxygen atoms (O)

To calculate the number of moles of oxygen in 1 mole of calcium carbonate, we multiply the number of oxygen atoms (3) by the Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3) = 3 moles of oxygen x (6.022 x 10^23 molecules/mol)

Calculating this value, we find:

Number of moles of oxygen (O) in 1 mole of calcium carbonate (CaCO3) ≈ 18.066 x 10^23 moles of oxygen

for more such questions on calcium

https://brainly.com/question/12216405

#SPJ8

Answer:

3

Explanation:

look after DP theres 3 digits

Answer:

ΔG = -8.812 kJ/mol

Explanation:

To obtain the free energy of a reaction you can use the expression:

ΔG = ΔG° + RT ln Q

Where:

ΔG° is Standard Gibbs Free energy: -16.7kJ/mol = -16700J/mol

R is gas constant: 8.314472 J/molK

T is absolute temperature (37°C + 273.15 = 310.15K)

And Q is reaction quotient: 21.3

Replacing in the formula:

ΔG = ΔG° + RT ln Q

ΔG = -16700J/mol + 8.314472J/molK*310.15K ln 21.3

ΔG = -8812.4J/mol

Answer:

First, we need to determine the molar mass of HCl.

The molar mass of HCl = the mass of hydrogen (1.008 g/mol) + the mass of chlorine (35.45 g/mol) = 36.45 g/mol.

Next, we can use Avogadro's number (6.02 x 10^23 molecules/mol) to convert the number of molecules to moles:

6.02 x 10^24 molecules / 6.02 x 10^23 molecules/mol = 10 moles

Finally, we can use the molar mass to convert moles to grams:

10 moles x 36.45 g/mol = 364.5 grams

Therefore, the mass of 6.02 x 10^24 molecules of HCl is 364.5 grams.

Answer: The molar mass of gas is 48.4 g/mol

Explanation:

To calculate the relation of density and molar mass of a compound, we use the ideal gas equation:

\(PV=nRT\)

P = pressure  = 851.2 mm Hg = 1.12 atm     ( 760 mm Hg = 1atm)

V = Volume  

n = number of moles

R = gas constant  = 0.0821 Latm/Kmol  

T = temperature  = \(2^0C=(2+273)K=275K\)

Number of moles (n) can be written as:

\(n=\frac{m}{M}\)

where, m = given mass

M = molar mass

where,

\(P=\frac{mRT}{MV}\)

\(P=\frac{dRT}{M}\)

where d = density

The relation becomes:

\(M=\frac{dRT}{P}\)

Putting the values we get :

\(M=\frac{2.40g/L\times 0.0821Latm/Kmol\times 275K}{1.12atm}\)

\(M=48.4g/mol\)

Thus molar mass of gas is 48.4 g/mol

Answer:

hydrochloric acid

Explanation:

chemical compound any substance composed of identical molecules consisting of atoms

As we continue to increase the available energy levels as shown by the principal quantum number and more electrons are added, the number of lines in the emission spectrum continues to increase.

Following  the Bohr model of the atom, We could have electrons travel from a higher to a lower energy level . Thus ow leads to the emission of light of a characteristic wavelength. This line is what constitutes the emission spectrum of an atom.

If is clear from the image attached to this answer that as we continue to increase the available energy levels as shown by the principal quantum number and more electrons are added, the number of lines in the emission spectrum continues to increase.

Learn more about spectrum:brainly.com/question/3997802

#SPJ1

Answer:

Mass number is a whole number because it is the sum of number of proton and number of neutrons whereas atomic mass is fractional because it is the average relative mass of its atoms as compared with mass an atom of C-12 isotope taken as 12.

hope it helps you

Answer:

The rows tell you how many shells there are of the atom.

Answer:

???

Explanation:

Answer:

1.59 M

Explanation:

What is the concentration (M) of CH₃OH a solution prepared by dissolving 11.7 g of CH₃OH sufficient water to give exactly 230 mL of solution?

Step 1: Given data

Step 2: Calculate the moles corresponding to 11.7 g of CH₃OH

The molar mass of CH₃OH is 32.04 g/mol.

11.7 g × 1 mol/32.04 g = 0.365 mol

Step 3: Calculate the molarity of the solution

M = moles of solute / liters of solution

M = 0.365 mol / 0.230 L = 1.59 M

Answer:

The answer is B.

Explanation:

The answer is be because they are all sharing the circuit, therefore they would all go out.  

A worker should feel a steady draft emerging from the face of the hood.

Emerging technology is defined as the application of new and innovative technologies to existing products and services to create new ones. This form of technology is often used as a way to gain competitive advantage in the market and to stay ahead of the competition. Examples of emerging technology include artificial intelligence (AI), virtual reality (VR), robotics, blockchain, and the Internet of Things (IoT). These new technologies have the potential to revolutionize the way we do business and provide new opportunities for both individuals and businesses. As such, many companies are investing heavily in the development of these technologies in order to stay ahead of the competition and remain competitive.

To learn more about emerging.
https://brainly.com/question/6459483
#SPJ4

The student's method for preparing pure crystals of copper sulfate contains errors and does not produce the desired outcome.

Use copper oxide instead of calcium carbonate: The student should add copper oxide (CuO) to the hydrochloric acid instead of calcium carbonate. Copper oxide reacts with hydrochloric acid to form copper chloride, which can then be converted to copper sulfate through a subsequent reaction with sulfuric acid.

Add sulfuric acid to the copper chloride solution: After the copper chloride solution is formed, the student should add sulfuric acid to it. This reaction between copper chloride and sulfuric acid will yield copper sulfate and hydrochloric acid. The student should ensure that the correct stoichiometric ratio is maintained to maximize the yield of copper sulfate crystals.

Crystal formation: The student should allow the solution to cool slowly after the reaction with sulfuric acid. This promotes the formation of larger, well-defined copper sulfate crystals.

Filtration and drying: Once the crystals have formed, the student should filter the solution to separate the solid crystals from the remaining liquid. The filtered crystals should then be thoroughly dried to remove any remaining water, resulting in pure copper sulfate crystals.

By following these improvements, the student can obtain pure crystals of copper sulfate.

For more such questions on copper sulfate visit:

https://brainly.com/question/17439051

#SPJ8

The molarity of vinegar is 0.47368421 moles per liter.

To calculate this, we can use the following formula:

molarity = (initial_volume - total_volume_change) / final_volume

In this case, the initial volume is 7.5 mL, the total volume change is 21 mL, and the final volume is 28.5 mL. Plugging these values into the formula, we get:

molarity = (7.5 - 21) / 28.5 = -0.47368421

The negative value for molarity indicates that the solution is diluted. This is because the total volume of the solution increased by 21 mL, while the amount of solute (acetic acid) remained the same.

It is important to note that the molarity of a solution can change depending on the temperature. This is because the volume of a solution expands as it gets warmer. Therefore, it is important to measure the volume and temperature of a solution at the same time to get an accurate measurement of its molarity.

For such more questions on molarity

https://brainly.com/question/30704561

#SPJ8

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

To ensure insurance coverage for Percocet, it is essential to verify the patient's insurance coverage and check if prior authorization is required. If prior authorization is necessary, gather the required information, complete the authorization form, and submit it to the insurance company.

When a patient presents a prescription for a medication like Percocet, which requires prior authorization from the insurance company, several steps should be taken:

Verify Insurance Coverage: Check the patient's insurance coverage and confirm if prior authorization is required for Percocet. This can be done by contacting the insurance company or using an online portal provided by the insurer.

Review Prior Authorization Criteria: Understand the specific requirements set by the insurance company for obtaining prior authorization for Percocet. This may include documentation, medical history, and supporting evidence to justify the need for the medication.

Gather Patient Information: Collect relevant patient information, including medical records, diagnosis, and any previous treatments. This information will be used to support the prior authorization request.

Complete Prior Authorization Form: Fill out the necessary prior authorization form provided by the insurance company. Ensure that all required information is accurately entered, including the patient's details, prescriber information, and supporting documentation.

Submit the Request: Send the completed prior authorization form along with any supporting documents to the insurance company. This can be done electronically through their designated channels or by fax/mail, following their specified process.

Follow Up: Monitor the progress of the prior authorization request. Follow up with the insurance company to confirm receipt, inquire about any additional information needed, and track the status of the request.

Inform the Patient: Keep the patient informed about the prior authorization process, estimated timelines, and any potential out-of-pocket costs they may incur.

For more question on Percocet

https://brainly.com/question/28649445

#SPJ8

The binding energy per nucleon for the ¹⁹F nucleon is equal to 7.786 MeV/nucleon.

Binding energy can be defined as the minimum quantity of energy that is required to remove the particle from the system. Nuclear binding energy can be described as the energy required to dismantle a nucleus of an atom into free neutrons and protons.

The binding energy will be determined from the mass defect. Mass defect is calculated from the difference between the mass observed and the expected combined mass.

Given the mass of the ¹⁹F = 18.9984 a.m.u.

The mass defect for the ¹⁹F can be calculated as:

Δm = \((M _n +M_p) - M_F\)

\(\triangle m =( 9\times 1.0078 + 10 \times 1.0087 )- 18.9984\)

\(\triangle m =0.1588 \;a.m.u.\)

The binding energy for the fluorine can be calculated as:

E = Δmc²

E = 0.1588 × 931.5

E = 147.92 MeV

The binding energy per nucleon of ¹⁹F can be calculated as:

B.E.N. = 147.92/18.9984 = 7.786 MeV per nucleon

Learn more about binding energy, here:

https://brainly.com/question/10095561

#SPJ1

The highest boiling point based on the data is option 4

Compared to alcohols of comparable molecular weight, carboxylic acids often have higher boiling temperatures. Between the hydrogen atoms of adjacent molecules and the oxygen in the carboxyl group of carboxylic acids, strong intermolecular hydrogen bonds can develop. Because it takes more energy to break the intermolecular interactions and change the substance from a liquid to a gas during boiling, these hydrogen bonds help materials have higher boiling temperatures.

Although carboxylic acids and alcohols are both capable of forming hydrogen bonds, carboxylic acids have higher boiling temperatures due to the extra carboxyl group that they contain.

Learn more about boiling point:https://brainly.com/question/1514229

#SPJ1

Nadia will take 8 seconds to reach her friend's house.

Speed is the measure of the distance traveled by an object per unit of time. It is a scalar quantity and is typically expressed in units such as meters per second (m/s), miles per hour (mph), or kilometers per hour (km/h).

To calculate the time Nadia will take to reach her friend's house, we can use the formula;

time = distance / speed

where distance is the amount of space traveled by an object, and time is the duration of travel.

Put the values given in the problem, we have:

time = 24 meters / 3 m/s

time = 8 seconds

Therefore, Nadia will take 8 seconds.

To know more about time here

https://brainly.com/question/15356513

#SPJ1